C20H19NO4 — CID 45485301
ethyl 5-[3-(1-phenoxyethyl)phenyl]-1,2-oxazole-3-carboxylate (PubChem CID 45485301) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is ethyl 5-[3-(1-phenoxyethyl)phenyl]-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-[3-(1-phenoxyethyl)phenyl]-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 45485301 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | ethyl 5-[3-(1-phenoxyethyl)phenyl]-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cccc(C(C)Oc3ccccc3)c2)on1 |
| InChI | InChI=1S/C20H19NO4/c1-3-23-20(22)18-13-19(25-21-18)16-9-7-8-15(12-16)14(2)24-17-10-5-4-6-11-17/h4-14H,3H2,1-2H3 |
| InChIKey | MWEFZWAQASBHLG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |