About 5-(benzenesulfonyl)-4-cyclopropyl-1,4-dihydropyrazolo[4,5-c]quinoline
5-(benzenesulfonyl)-4-cyclopropyl-1,4-dihydropyrazolo[4,5-c]quinoline (PubChem CID 45485436) has the molecular formula C19H17N3O2S
and a molecular weight of 351.43 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-4-cyclopropyl-1,4-dihydropyrazolo[4,5-c]quinoline.
Molecular Properties
| Compound Name | 5-(benzenesulfonyl)-4-cyclopropyl-1,4-dihydropyrazolo[4,5-c]quinoline |
| PubChem CID | 45485436 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 5-(benzenesulfonyl)-4-cyclopropyl-1,4-dihydropyrazolo[4,5-c]quinoline |
| SMILES | O=S(=O)(c1ccccc1)N1c2ccccc2-c2[nH]ncc2C1C1CC1 |
| InChI | InChI=1S/C19H17N3O2S/c23-25(24,14-6-2-1-3-7-14)22-17-9-5-4-8-15(17)18-16(12-20-21-18)19(22)13-10-11-13/h1-9,12-13,19H,10-11H2,(H,20,21) |
| InChIKey | YEPOEURJNMOUOI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(benzenesulfonyl)-4-cyclopropyl-1,4-dihydropyrazolo[4,5-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(benzenesulfonyl)-4-cyclopropyl-1,4-dihydropyrazolo[4,5-c]quinoline?
The IUPAC name of 5-(benzenesulfonyl)-4-cyclopropyl-1,4-dihydropyrazolo[4,5-c]quinoline (CID 45485436) is 5-(benzenesulfonyl)-4-cyclopropyl-1,4-dihydropyrazolo[4,5-c]quinoline.
What is the SMILES notation for 5-(benzenesulfonyl)-4-cyclopropyl-1,4-dihydropyrazolo[4,5-c]quinoline?
The canonical SMILES for 5-(benzenesulfonyl)-4-cyclopropyl-1,4-dihydropyrazolo[4,5-c]quinoline is O=S(=O)(c1ccccc1)N1c2ccccc2-c2[nH]ncc2C1C1CC1.
What is the InChIKey of 5-(benzenesulfonyl)-4-cyclopropyl-1,4-dihydropyrazolo[4,5-c]quinoline?
The InChIKey is YEPOEURJNMOUOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3O2S/c23-25(24,14-6-2-1-3-7-14)22-17-9-5-4-8-15(17)18-16(12-20-21-18)19(22)13-10-11-13/h1-9,12-13,19H,10-11H2,(H,20,21).
What are the key properties of 5-(benzenesulfonyl)-4-cyclopropyl-1,4-dihydropyrazolo[4,5-c]quinoline?
5-(benzenesulfonyl)-4-cyclopropyl-1,4-dihydropyrazolo[4,5-c]quinoline has a molecular weight of 351.43 g/mol, XLogP of 3.74, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(benzenesulfonyl)-4-cyclopropyl-1,4-dihydropyrazolo[4,5-c]quinoline is sourced from PubChem (CID 45485436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).