C27H47N3O6 — CID 45485454
[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[(2R)-1-[3-(dimethylamino)propylamino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 45485454) has the molecular formula C27H47N3O6 and a molecular weight of 509.69 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[(2R)-1-[3-(dimethylamino)propylamino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[(2R)-1-[3-(dimethylamino)propylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 45485454 |
| Molecular Formula | C27H47N3O6 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.35 |
| IUPAC Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[(2R)-1-[3-(dimethylamino)propylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CO[C@@H]1[C@H](OC(=O)N[C@@H](C(=O)NCCCN(C)C)C(C)C)CC[C@]2(CO2)[C@H]1[C@@]1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C27H47N3O6/c1-17(2)10-11-20-26(5,36-20)23-22(33-8)19(12-13-27(23)16-34-27)35-25(32)29-21(18(3)4)24(31)28-14-9-15-30(6)7/h10,18-23H,9,11-16H2,1-8H3,(H,28,31)(H,29,32)/t19-,20-,21-,22-,23-,26+,27+/m1/s1 |
| InChIKey | XUUIUMCHCSOIJO-GDJJCEENSA-N |
| XLogP | 2.88 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|