C18H21N3O4 — CID 45485561
methyl 3-[4-[[2-(4-methoxyphenyl)acetyl]amino]imidazol-1-yl]cyclobutane-1-carboxylate (PubChem CID 45485561) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is methyl 3-[4-[[2-(4-methoxyphenyl)acetyl]amino]imidazol-1-yl]cyclobutane-1-carboxylate.
| Compound Name | methyl 3-[4-[[2-(4-methoxyphenyl)acetyl]amino]imidazol-1-yl]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 45485561 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | methyl 3-[4-[[2-(4-methoxyphenyl)acetyl]amino]imidazol-1-yl]cyclobutane-1-carboxylate |
| SMILES | COC(=O)C1CC(n2cnc(NC(=O)Cc3ccc(OC)cc3)c2)C1 |
| InChI | InChI=1S/C18H21N3O4/c1-24-15-5-3-12(4-6-15)7-17(22)20-16-10-21(11-19-16)14-8-13(9-14)18(23)25-2/h3-6,10-11,13-14H,7-9H2,1-2H3,(H,20,22) |
| InChIKey | RMQMCGSCLKFYRU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |