C23H31N3O2 — CID 45485826
N,N-diethyl-4-(3-hydroxy-N-(1-methylpiperidin-4-yl)anilino)benzamide (PubChem CID 45485826) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is N,N-diethyl-4-(3-hydroxy-N-(1-methylpiperidin-4-yl)anilino)benzamide.
| Compound Name | N,N-diethyl-4-(3-hydroxy-N-(1-methylpiperidin-4-yl)anilino)benzamide |
|---|---|
| PubChem CID | 45485826 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | N,N-diethyl-4-(3-hydroxy-N-(1-methylpiperidin-4-yl)anilino)benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(N(c2cccc(O)c2)C2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C23H31N3O2/c1-4-25(5-2)23(28)18-9-11-19(12-10-18)26(20-13-15-24(3)16-14-20)21-7-6-8-22(27)17-21/h6-12,17,20,27H,4-5,13-16H2,1-3H3 |
| InChIKey | CBAXBKFTFAZJRB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |