C25H32N2O5 — CID 45486060
(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carboxylate (PubChem CID 45486060) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carboxylate.
| Compound Name | (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carboxylate |
|---|---|
| PubChem CID | 45486060 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carboxylate |
| SMILES | CC1(C)CC(OC(=O)c2cc3cc4c5c(c3oc2=O)CCCN5CCC4)CC(C)(C)N1O |
| InChI | InChI=1S/C25H32N2O5/c1-24(2)13-17(14-25(3,4)27(24)30)31-22(28)19-12-16-11-15-7-5-9-26-10-6-8-18(20(15)26)21(16)32-23(19)29/h11-12,17,30H,5-10,13-14H2,1-4H3 |
| InChIKey | NDEYNBVKGAPBIG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|