C25H34N6S — CID 45486325
(6S)-6-N-propyl-6-N-[2-(4-quinolin-4-ylpiperazin-1-yl)ethyl]-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine (PubChem CID 45486325) has the molecular formula C25H34N6S and a molecular weight of 450.66 g/mol. Its IUPAC name is (6S)-6-N-propyl-6-N-[2-(4-quinolin-4-ylpiperazin-1-yl)ethyl]-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine.
| Compound Name | (6S)-6-N-propyl-6-N-[2-(4-quinolin-4-ylpiperazin-1-yl)ethyl]-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine |
|---|---|
| PubChem CID | 45486325 |
| Molecular Formula | C25H34N6S |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | (6S)-6-N-propyl-6-N-[2-(4-quinolin-4-ylpiperazin-1-yl)ethyl]-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine |
| SMILES | CCCN(CCN1CCN(c2ccnc3ccccc23)CC1)[C@H]1CCc2nc(N)sc2C1 |
| InChI | InChI=1S/C25H34N6S/c1-2-11-30(19-7-8-22-24(18-19)32-25(26)28-22)15-12-29-13-16-31(17-14-29)23-9-10-27-21-6-4-3-5-20(21)23/h3-6,9-10,19H,2,7-8,11-18H2,1H3,(H2,26,28)/t19-/m0/s1 |
| InChIKey | ZYOHPRMTOCMZRK-IBGZPJMESA-N |
| XLogP | 3.66 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |