C27H28F2N2O — CID 45486377
(2R)-2-[(5aR,6S)-1-(4-fluorophenyl)-5a-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-b]isoquinolin-6-yl]-1-(4-fluorophenyl)propan-2-ol (PubChem CID 45486377) has the molecular formula C27H28F2N2O and a molecular weight of 434.53 g/mol. Its IUPAC name is (2R)-2-[(5aR,6S)-1-(4-fluorophenyl)-5a-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-b]isoquinolin-6-yl]-1-(4-fluorophenyl)propan-2-ol.
| Compound Name | (2R)-2-[(5aR,6S)-1-(4-fluorophenyl)-5a-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-b]isoquinolin-6-yl]-1-(4-fluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 45486377 |
| Molecular Formula | C27H28F2N2O |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | (2R)-2-[(5aR,6S)-1-(4-fluorophenyl)-5a-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-b]isoquinolin-6-yl]-1-(4-fluorophenyl)propan-2-ol |
| SMILES | C[C@]12Cn3cnc(-c4ccc(F)cc4)c3C=C1CCC[C@@H]2[C@](C)(O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C27H28F2N2O/c1-26-16-31-17-30-25(19-8-12-22(29)13-9-19)23(31)14-20(26)4-3-5-24(26)27(2,32)15-18-6-10-21(28)11-7-18/h6-14,17,24,32H,3-5,15-16H2,1-2H3/t24-,26-,27+/m0/s1 |
| InChIKey | WURAKPAOMDMLLY-DOEKTCAHSA-N |
| XLogP | 6.03 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |