C23H27FN2O — CID 45486385
(1R)-1-[(5aR,6S)-1-(4-fluorophenyl)-5a-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-b]isoquinolin-6-yl]-1-cyclopropylethanol (PubChem CID 45486385) has the molecular formula C23H27FN2O and a molecular weight of 366.48 g/mol. Its IUPAC name is (1R)-1-[(5aR,6S)-1-(4-fluorophenyl)-5a-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-b]isoquinolin-6-yl]-1-cyclopropylethanol.
| Compound Name | (1R)-1-[(5aR,6S)-1-(4-fluorophenyl)-5a-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-b]isoquinolin-6-yl]-1-cyclopropylethanol |
|---|---|
| PubChem CID | 45486385 |
| Molecular Formula | C23H27FN2O |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | (1R)-1-[(5aR,6S)-1-(4-fluorophenyl)-5a-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-b]isoquinolin-6-yl]-1-cyclopropylethanol |
| SMILES | C[C@]12Cn3cnc(-c4ccc(F)cc4)c3C=C1CCC[C@@H]2[C@](C)(O)C1CC1 |
| InChI | InChI=1S/C23H27FN2O/c1-22-13-26-14-25-21(15-6-10-18(24)11-7-15)19(26)12-17(22)4-3-5-20(22)23(2,27)16-8-9-16/h6-7,10-12,14,16,20,27H,3-5,8-9,13H2,1-2H3/t20-,22-,23+/m0/s1 |
| InChIKey | BNACLTNZCKWBBX-ACIOBRDBSA-N |
| XLogP | 5.05 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |