C27H29FN2O — CID 45486424
(1S)-1-[(5aR,6S)-1-(4-fluorophenyl)-5a-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-b]isoquinolin-6-yl]-1-(3-methylphenyl)ethanol (PubChem CID 45486424) has the molecular formula C27H29FN2O and a molecular weight of 416.54 g/mol. Its IUPAC name is (1S)-1-[(5aR,6S)-1-(4-fluorophenyl)-5a-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-b]isoquinolin-6-yl]-1-(3-methylphenyl)ethanol.
| Compound Name | (1S)-1-[(5aR,6S)-1-(4-fluorophenyl)-5a-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-b]isoquinolin-6-yl]-1-(3-methylphenyl)ethanol |
|---|---|
| PubChem CID | 45486424 |
| Molecular Formula | C27H29FN2O |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | (1S)-1-[(5aR,6S)-1-(4-fluorophenyl)-5a-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-b]isoquinolin-6-yl]-1-(3-methylphenyl)ethanol |
| SMILES | Cc1cccc([C@@](C)(O)[C@H]2CCCC3=Cc4c(-c5ccc(F)cc5)ncn4C[C@@]32C)c1 |
| InChI | InChI=1S/C27H29FN2O/c1-18-6-4-8-21(14-18)27(3,31)24-9-5-7-20-15-23-25(19-10-12-22(28)13-11-19)29-17-30(23)16-26(20,24)2/h4,6,8,10-15,17,24,31H,5,7,9,16H2,1-3H3/t24-,26-,27+/m0/s1 |
| InChIKey | PZXDYRZHRISNBO-DOEKTCAHSA-N |
| XLogP | 6.11 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |