C36H40N14O2 — CID 45486430
4-[2-[[4-(3-aminoanilino)-6-[4-[2-[[4-(3-aminoanilino)-6-(2-hydroxyethylamino)-1,3,5-triazin-2-yl]amino]ethyl]anilino]-1,3,5-triazin-2-yl]amino]ethyl]phenol (PubChem CID 45486430) has the molecular formula C36H40N14O2 and a molecular weight of 700.81 g/mol. Its IUPAC name is 4-[2-[[4-(3-aminoanilino)-6-[4-[2-[[4-(3-aminoanilino)-6-(2-hydroxyethylamino)-1,3,5-triazin-2-yl]amino]ethyl]anilino]-1,3,5-triazin-2-yl]amino]ethyl]phenol.
| Compound Name | 4-[2-[[4-(3-aminoanilino)-6-[4-[2-[[4-(3-aminoanilino)-6-(2-hydroxyethylamino)-1,3,5-triazin-2-yl]amino]ethyl]anilino]-1,3,5-triazin-2-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 45486430 |
| Molecular Formula | C36H40N14O2 |
| Molecular Weight | 700.81 g/mol |
| Exact Mass | 700.35 |
| IUPAC Name | 4-[2-[[4-(3-aminoanilino)-6-[4-[2-[[4-(3-aminoanilino)-6-(2-hydroxyethylamino)-1,3,5-triazin-2-yl]amino]ethyl]anilino]-1,3,5-triazin-2-yl]amino]ethyl]phenol |
| SMILES | Nc1cccc(Nc2nc(NCCO)nc(NCCc3ccc(Nc4nc(NCCc5ccc(O)cc5)nc(Nc5cccc(N)c5)n4)cc3)n2)c1 |
| InChI | InChI=1S/C36H40N14O2/c37-25-3-1-5-28(21-25)43-35-46-31(45-33(49-35)41-19-20-51)39-17-15-23-7-11-27(12-8-23)42-34-47-32(40-18-16-24-9-13-30(52)14-10-24)48-36(50-34)44-29-6-2-4-26(38)22-29/h1-14,21-22,51-52H,15-20,37-38H2,(H3,39,41,43,45,46,49)(H3,40,42,44,47,48,50) |
| InChIKey | VIXSUBPKQFBESY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 242.02 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.81 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|