C25H24F2N2O — CID 45486436
(S)-[(5aR,6S)-1-(4-fluorophenyl)-5a-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-b]isoquinolin-6-yl]-(4-fluorophenyl)methanol (PubChem CID 45486436) has the molecular formula C25H24F2N2O and a molecular weight of 406.48 g/mol. Its IUPAC name is (S)-[(5aR,6S)-1-(4-fluorophenyl)-5a-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-b]isoquinolin-6-yl]-(4-fluorophenyl)methanol.
| Compound Name | (S)-[(5aR,6S)-1-(4-fluorophenyl)-5a-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-b]isoquinolin-6-yl]-(4-fluorophenyl)methanol |
|---|---|
| PubChem CID | 45486436 |
| Molecular Formula | C25H24F2N2O |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | (S)-[(5aR,6S)-1-(4-fluorophenyl)-5a-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-b]isoquinolin-6-yl]-(4-fluorophenyl)methanol |
| SMILES | C[C@]12Cn3cnc(-c4ccc(F)cc4)c3C=C1CCC[C@@H]2[C@H](O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H24F2N2O/c1-25-14-29-15-28-23(16-5-9-19(26)10-6-16)22(29)13-18(25)3-2-4-21(25)24(30)17-7-11-20(27)12-8-17/h5-13,15,21,24,30H,2-4,14H2,1H3/t21-,24-,25+/m1/s1 |
| InChIKey | YXQPDNYJXVGIES-SDUSCBPUSA-N |
| XLogP | 5.77 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |