C24H31FN2O — CID 45486439
(2R)-2-[(5aR,6S)-1-(4-fluorophenyl)-5a-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-b]isoquinolin-6-yl]-4-methylpentan-2-ol (PubChem CID 45486439) has the molecular formula C24H31FN2O and a molecular weight of 382.52 g/mol. Its IUPAC name is (2R)-2-[(5aR,6S)-1-(4-fluorophenyl)-5a-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-b]isoquinolin-6-yl]-4-methylpentan-2-ol.
| Compound Name | (2R)-2-[(5aR,6S)-1-(4-fluorophenyl)-5a-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-b]isoquinolin-6-yl]-4-methylpentan-2-ol |
|---|---|
| PubChem CID | 45486439 |
| Molecular Formula | C24H31FN2O |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | (2R)-2-[(5aR,6S)-1-(4-fluorophenyl)-5a-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-b]isoquinolin-6-yl]-4-methylpentan-2-ol |
| SMILES | CC(C)C[C@@](C)(O)[C@H]1CCCC2=Cc3c(-c4ccc(F)cc4)ncn3C[C@@]21C |
| InChI | InChI=1S/C24H31FN2O/c1-16(2)13-24(4,28)21-7-5-6-18-12-20-22(17-8-10-19(25)11-9-17)26-15-27(20)14-23(18,21)3/h8-12,15-16,21,28H,5-7,13-14H2,1-4H3/t21-,23-,24+/m0/s1 |
| InChIKey | FVNUALGZXXEUEP-OEMFJLHTSA-N |
| XLogP | 5.69 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |