C24H28ClN5O2 — CID 45486654
1-(2-chlorophenyl)-3-[3-(2-methylpyrazol-3-yl)-4-(2-piperidin-1-ylethoxy)phenyl]urea (PubChem CID 45486654) has the molecular formula C24H28ClN5O2 and a molecular weight of 453.97 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[3-(2-methylpyrazol-3-yl)-4-(2-piperidin-1-ylethoxy)phenyl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[3-(2-methylpyrazol-3-yl)-4-(2-piperidin-1-ylethoxy)phenyl]urea |
|---|---|
| PubChem CID | 45486654 |
| Molecular Formula | C24H28ClN5O2 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[3-(2-methylpyrazol-3-yl)-4-(2-piperidin-1-ylethoxy)phenyl]urea |
| SMILES | Cn1nccc1-c1cc(NC(=O)Nc2ccccc2Cl)ccc1OCCN1CCCCC1 |
| InChI | InChI=1S/C24H28ClN5O2/c1-29-22(11-12-26-29)19-17-18(27-24(31)28-21-8-4-3-7-20(21)25)9-10-23(19)32-16-15-30-13-5-2-6-14-30/h3-4,7-12,17H,2,5-6,13-16H2,1H3,(H2,27,28,31) |
| InChIKey | WPQIEXDUXUHJGL-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |