About 4-[[3-nitro-6-(2,4,6-trimethylphenoxy)-2-pyridinyl]amino]benzonitrile
4-[[3-nitro-6-(2,4,6-trimethylphenoxy)-2-pyridinyl]amino]benzonitrile (PubChem CID 45486674) has the molecular formula C21H18N4O3
and a molecular weight of 374.40 g/mol. Its IUPAC name is 4-[[3-nitro-6-(2,4,6-trimethylphenoxy)-2-pyridinyl]amino]benzonitrile.
Molecular Properties
| Compound Name | 4-[[3-nitro-6-(2,4,6-trimethylphenoxy)-2-pyridinyl]amino]benzonitrile |
| PubChem CID | 45486674 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 4-[[3-nitro-6-(2,4,6-trimethylphenoxy)-2-pyridinyl]amino]benzonitrile |
| SMILES | Cc1cc(C)c(Oc2ccc([N+](=O)[O-])c(Nc3ccc(C#N)cc3)n2)c(C)c1 |
| InChI | InChI=1S/C21H18N4O3/c1-13-10-14(2)20(15(3)11-13)28-19-9-8-18(25(26)27)21(24-19)23-17-6-4-16(12-22)5-7-17/h4-11H,1-3H3,(H,23,24) |
| InChIKey | VQFCREZXWROWRQ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[[3-nitro-6-(2,4,6-trimethylphenoxy)-2-pyridinyl]amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3-nitro-6-(2,4,6-trimethylphenoxy)-2-pyridinyl]amino]benzonitrile?
The IUPAC name of 4-[[3-nitro-6-(2,4,6-trimethylphenoxy)-2-pyridinyl]amino]benzonitrile (CID 45486674) is 4-[[3-nitro-6-(2,4,6-trimethylphenoxy)-2-pyridinyl]amino]benzonitrile.
What is the SMILES notation for 4-[[3-nitro-6-(2,4,6-trimethylphenoxy)-2-pyridinyl]amino]benzonitrile?
The canonical SMILES for 4-[[3-nitro-6-(2,4,6-trimethylphenoxy)-2-pyridinyl]amino]benzonitrile is Cc1cc(C)c(Oc2ccc([N+](=O)[O-])c(Nc3ccc(C#N)cc3)n2)c(C)c1.
What is the InChIKey of 4-[[3-nitro-6-(2,4,6-trimethylphenoxy)-2-pyridinyl]amino]benzonitrile?
The InChIKey is VQFCREZXWROWRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N4O3/c1-13-10-14(2)20(15(3)11-13)28-19-9-8-18(25(26)27)21(24-19)23-17-6-4-16(12-22)5-7-17/h4-11H,1-3H3,(H,23,24).
What are the key properties of 4-[[3-nitro-6-(2,4,6-trimethylphenoxy)-2-pyridinyl]amino]benzonitrile?
4-[[3-nitro-6-(2,4,6-trimethylphenoxy)-2-pyridinyl]amino]benzonitrile has a molecular weight of 374.40 g/mol, XLogP of 5.32, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-nitro-6-(2,4,6-trimethylphenoxy)-2-pyridinyl]amino]benzonitrile is sourced from PubChem (CID 45486674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).