About 4-[[6-(4-iodo-2,6-dimethylphenoxy)-3-nitro-2-pyridinyl]amino]benzonitrile
4-[[6-(4-iodo-2,6-dimethylphenoxy)-3-nitro-2-pyridinyl]amino]benzonitrile (PubChem CID 45486728) has the molecular formula C20H15IN4O3
and a molecular weight of 486.27 g/mol. Its IUPAC name is 4-[[6-(4-iodo-2,6-dimethylphenoxy)-3-nitro-2-pyridinyl]amino]benzonitrile.
Molecular Properties
| Compound Name | 4-[[6-(4-iodo-2,6-dimethylphenoxy)-3-nitro-2-pyridinyl]amino]benzonitrile |
| PubChem CID | 45486728 |
| Molecular Formula | C20H15IN4O3 |
| Molecular Weight | 486.27 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | 4-[[6-(4-iodo-2,6-dimethylphenoxy)-3-nitro-2-pyridinyl]amino]benzonitrile |
| SMILES | Cc1cc(I)cc(C)c1Oc1ccc([N+](=O)[O-])c(Nc2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C20H15IN4O3/c1-12-9-15(21)10-13(2)19(12)28-18-8-7-17(25(26)27)20(24-18)23-16-5-3-14(11-22)4-6-16/h3-10H,1-2H3,(H,23,24) |
| InChIKey | KDTOBOGOASPAPF-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.27 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[[6-(4-iodo-2,6-dimethylphenoxy)-3-nitro-2-pyridinyl]amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[6-(4-iodo-2,6-dimethylphenoxy)-3-nitro-2-pyridinyl]amino]benzonitrile?
The IUPAC name of 4-[[6-(4-iodo-2,6-dimethylphenoxy)-3-nitro-2-pyridinyl]amino]benzonitrile (CID 45486728) is 4-[[6-(4-iodo-2,6-dimethylphenoxy)-3-nitro-2-pyridinyl]amino]benzonitrile.
What is the SMILES notation for 4-[[6-(4-iodo-2,6-dimethylphenoxy)-3-nitro-2-pyridinyl]amino]benzonitrile?
The canonical SMILES for 4-[[6-(4-iodo-2,6-dimethylphenoxy)-3-nitro-2-pyridinyl]amino]benzonitrile is Cc1cc(I)cc(C)c1Oc1ccc([N+](=O)[O-])c(Nc2ccc(C#N)cc2)n1.
What is the InChIKey of 4-[[6-(4-iodo-2,6-dimethylphenoxy)-3-nitro-2-pyridinyl]amino]benzonitrile?
The InChIKey is KDTOBOGOASPAPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15IN4O3/c1-12-9-15(21)10-13(2)19(12)28-18-8-7-17(25(26)27)20(24-18)23-16-5-3-14(11-22)4-6-16/h3-10H,1-2H3,(H,23,24).
What are the key properties of 4-[[6-(4-iodo-2,6-dimethylphenoxy)-3-nitro-2-pyridinyl]amino]benzonitrile?
4-[[6-(4-iodo-2,6-dimethylphenoxy)-3-nitro-2-pyridinyl]amino]benzonitrile has a molecular weight of 486.27 g/mol, XLogP of 5.62, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[6-(4-iodo-2,6-dimethylphenoxy)-3-nitro-2-pyridinyl]amino]benzonitrile is sourced from PubChem (CID 45486728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).