C23H27N5O5S — CID 45486768
N-[(4-carbamimidoylphenyl)methyl]-2-[1-[(3-methoxyphenyl)sulfonylamino]-4-methyl-6-oxo-2,3-dihydropyridin-5-yl]acetamide (PubChem CID 45486768) has the molecular formula C23H27N5O5S and a molecular weight of 485.57 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-2-[1-[(3-methoxyphenyl)sulfonylamino]-4-methyl-6-oxo-2,3-dihydropyridin-5-yl]acetamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-2-[1-[(3-methoxyphenyl)sulfonylamino]-4-methyl-6-oxo-2,3-dihydropyridin-5-yl]acetamide |
|---|---|
| PubChem CID | 45486768 |
| Molecular Formula | C23H27N5O5S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-2-[1-[(3-methoxyphenyl)sulfonylamino]-4-methyl-6-oxo-2,3-dihydropyridin-5-yl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)CC2=C(C)CCN(NS(=O)(=O)c3cccc(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C23H27N5O5S/c1-15-10-11-28(27-34(31,32)19-5-3-4-18(12-19)33-2)23(30)20(15)13-21(29)26-14-16-6-8-17(9-7-16)22(24)25/h3-9,12,27H,10-11,13-14H2,1-2H3,(H3,24,25)(H,26,29) |
| InChIKey | GLLWYOZKMXWFJX-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 154.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|