C14H12N4 — CID 45486831
5-methyl-2,4,8,9-tetrazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(17),3,5,9,11,13,15-heptaene (PubChem CID 45486831) has the molecular formula C14H12N4 and a molecular weight of 236.28 g/mol. Its IUPAC name is 5-methyl-2,4,8,9-tetrazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(17),3,5,9,11,13,15-heptaene.
| Compound Name | 5-methyl-2,4,8,9-tetrazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(17),3,5,9,11,13,15-heptaene |
|---|---|
| PubChem CID | 45486831 |
| Molecular Formula | C14H12N4 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 5-methyl-2,4,8,9-tetrazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(17),3,5,9,11,13,15-heptaene |
| SMILES | Cc1ncn2c1Cn1nccc1-c1ccccc1-2 |
| InChI | InChI=1S/C14H12N4/c1-10-14-8-18-13(6-7-16-18)11-4-2-3-5-12(11)17(14)9-15-10/h2-7,9H,8H2,1H3 |
| InChIKey | BKGDQBJGYREIHW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |