About 4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-2,3-difluorobenzonitrile
4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-2,3-difluorobenzonitrile (PubChem CID 45486864) has the molecular formula C16H17F2N3O2
and a molecular weight of 321.33 g/mol. Its IUPAC name is 4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-2,3-difluorobenzonitrile.
Molecular Properties
| Compound Name | 4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-2,3-difluorobenzonitrile |
| PubChem CID | 45486864 |
| Molecular Formula | C16H17F2N3O2 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-2,3-difluorobenzonitrile |
| SMILES | CCc1nn(CCO)c(CC)c1Oc1ccc(C#N)c(F)c1F |
| InChI | InChI=1S/C16H17F2N3O2/c1-3-11-16(12(4-2)21(20-11)7-8-22)23-13-6-5-10(9-19)14(17)15(13)18/h5-6,22H,3-4,7-8H2,1-2H3 |
| InChIKey | UHBVDAYGTJVEIF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 71.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-2,3-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-2,3-difluorobenzonitrile?
The IUPAC name of 4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-2,3-difluorobenzonitrile (CID 45486864) is 4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-2,3-difluorobenzonitrile.
What is the SMILES notation for 4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-2,3-difluorobenzonitrile?
The canonical SMILES for 4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-2,3-difluorobenzonitrile is CCc1nn(CCO)c(CC)c1Oc1ccc(C#N)c(F)c1F.
What is the InChIKey of 4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-2,3-difluorobenzonitrile?
The InChIKey is UHBVDAYGTJVEIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F2N3O2/c1-3-11-16(12(4-2)21(20-11)7-8-22)23-13-6-5-10(9-19)14(17)15(13)18/h5-6,22H,3-4,7-8H2,1-2H3.
What are the key properties of 4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-2,3-difluorobenzonitrile?
4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-2,3-difluorobenzonitrile has a molecular weight of 321.33 g/mol, XLogP of 2.94, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-2,3-difluorobenzonitrile is sourced from PubChem (CID 45486864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).