C15H18F2N2O2 — CID 45486871
2-[4-(2,3-difluorophenoxy)-3,5-diethylpyrazol-1-yl]ethanol (PubChem CID 45486871) has the molecular formula C15H18F2N2O2 and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-[4-(2,3-difluorophenoxy)-3,5-diethylpyrazol-1-yl]ethanol.
| Compound Name | 2-[4-(2,3-difluorophenoxy)-3,5-diethylpyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 45486871 |
| Molecular Formula | C15H18F2N2O2 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-[4-(2,3-difluorophenoxy)-3,5-diethylpyrazol-1-yl]ethanol |
| SMILES | CCc1nn(CCO)c(CC)c1Oc1cccc(F)c1F |
| InChI | InChI=1S/C15H18F2N2O2/c1-3-11-15(12(4-2)19(18-11)8-9-20)21-13-7-5-6-10(16)14(13)17/h5-7,20H,3-4,8-9H2,1-2H3 |
| InChIKey | NYCJCEDZGLSYBO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |