About 3-chloro-4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxybenzonitrile
3-chloro-4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxybenzonitrile (PubChem CID 45486877) has the molecular formula C16H18ClN3O2
and a molecular weight of 319.79 g/mol. Its IUPAC name is 3-chloro-4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxybenzonitrile.
Molecular Properties
| Compound Name | 3-chloro-4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxybenzonitrile |
| PubChem CID | 45486877 |
| Molecular Formula | C16H18ClN3O2 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 3-chloro-4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxybenzonitrile |
| SMILES | CCc1nn(CCO)c(CC)c1Oc1ccc(C#N)cc1Cl |
| InChI | InChI=1S/C16H18ClN3O2/c1-3-13-16(14(4-2)20(19-13)7-8-21)22-15-6-5-11(10-18)9-12(15)17/h5-6,9,21H,3-4,7-8H2,1-2H3 |
| InChIKey | PPGHDMMVAVVUQA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 71.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-chloro-4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxybenzonitrile?
The IUPAC name of 3-chloro-4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxybenzonitrile (CID 45486877) is 3-chloro-4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxybenzonitrile.
What is the SMILES notation for 3-chloro-4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxybenzonitrile?
The canonical SMILES for 3-chloro-4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxybenzonitrile is CCc1nn(CCO)c(CC)c1Oc1ccc(C#N)cc1Cl.
What is the InChIKey of 3-chloro-4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxybenzonitrile?
The InChIKey is PPGHDMMVAVVUQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18ClN3O2/c1-3-13-16(14(4-2)20(19-13)7-8-21)22-15-6-5-11(10-18)9-12(15)17/h5-6,9,21H,3-4,7-8H2,1-2H3.
What are the key properties of 3-chloro-4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxybenzonitrile?
3-chloro-4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxybenzonitrile has a molecular weight of 319.79 g/mol, XLogP of 3.32, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxybenzonitrile is sourced from PubChem (CID 45486877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).