About 4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-3,5-dimethylbenzonitrile
4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-3,5-dimethylbenzonitrile (PubChem CID 45486901) has the molecular formula C18H23N3O2
and a molecular weight of 313.40 g/mol. Its IUPAC name is 4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-3,5-dimethylbenzonitrile.
Molecular Properties
| Compound Name | 4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-3,5-dimethylbenzonitrile |
| PubChem CID | 45486901 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-3,5-dimethylbenzonitrile |
| SMILES | CCc1nn(CCO)c(CC)c1Oc1c(C)cc(C#N)cc1C |
| InChI | InChI=1S/C18H23N3O2/c1-5-15-18(16(6-2)21(20-15)7-8-22)23-17-12(3)9-14(11-19)10-13(17)4/h9-10,22H,5-8H2,1-4H3 |
| InChIKey | JDQHMHHWRMQUGN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 71.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-3,5-dimethylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-3,5-dimethylbenzonitrile?
The IUPAC name of 4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-3,5-dimethylbenzonitrile (CID 45486901) is 4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-3,5-dimethylbenzonitrile.
What is the SMILES notation for 4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-3,5-dimethylbenzonitrile?
The canonical SMILES for 4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-3,5-dimethylbenzonitrile is CCc1nn(CCO)c(CC)c1Oc1c(C)cc(C#N)cc1C.
What is the InChIKey of 4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-3,5-dimethylbenzonitrile?
The InChIKey is JDQHMHHWRMQUGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O2/c1-5-15-18(16(6-2)21(20-15)7-8-22)23-17-12(3)9-14(11-19)10-13(17)4/h9-10,22H,5-8H2,1-4H3.
What are the key properties of 4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-3,5-dimethylbenzonitrile?
4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-3,5-dimethylbenzonitrile has a molecular weight of 313.40 g/mol, XLogP of 3.28, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxy-3,5-dimethylbenzonitrile is sourced from PubChem (CID 45486901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).