C30H34N4O4 — CID 45486908
2-[2-amino-1-(3,4-dimethoxyphenyl)ethyl]-4-[4-[(1S)-1-phenylethyl]piperazin-1-yl]isoindole-1,3-dione (PubChem CID 45486908) has the molecular formula C30H34N4O4 and a molecular weight of 514.63 g/mol. Its IUPAC name is 2-[2-amino-1-(3,4-dimethoxyphenyl)ethyl]-4-[4-[(1S)-1-phenylethyl]piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[2-amino-1-(3,4-dimethoxyphenyl)ethyl]-4-[4-[(1S)-1-phenylethyl]piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 45486908 |
| Molecular Formula | C30H34N4O4 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | 2-[2-amino-1-(3,4-dimethoxyphenyl)ethyl]-4-[4-[(1S)-1-phenylethyl]piperazin-1-yl]isoindole-1,3-dione |
| SMILES | COc1ccc(C(CN)N2C(=O)c3cccc(N4CCN([C@@H](C)c5ccccc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C30H34N4O4/c1-20(21-8-5-4-6-9-21)32-14-16-33(17-15-32)24-11-7-10-23-28(24)30(36)34(29(23)35)25(19-31)22-12-13-26(37-2)27(18-22)38-3/h4-13,18,20,25H,14-17,19,31H2,1-3H3/t20-,25?/m0/s1 |
| InChIKey | GARZUTMCULGOHF-JINQPTGOSA-N |
| XLogP | 3.88 |
| TPSA | 88.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|