C35H42N4O6 — CID 45486909
tert-butyl N-[2-(3,4-dimethoxyphenyl)-2-[1,3-dioxo-4-[4-[(1S)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]ethyl]carbamate (PubChem CID 45486909) has the molecular formula C35H42N4O6 and a molecular weight of 614.74 g/mol. Its IUPAC name is tert-butyl N-[2-(3,4-dimethoxyphenyl)-2-[1,3-dioxo-4-[4-[(1S)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(3,4-dimethoxyphenyl)-2-[1,3-dioxo-4-[4-[(1S)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 45486909 |
| Molecular Formula | C35H42N4O6 |
| Molecular Weight | 614.74 g/mol |
| Exact Mass | 614.31 |
| IUPAC Name | tert-butyl N-[2-(3,4-dimethoxyphenyl)-2-[1,3-dioxo-4-[4-[(1S)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]ethyl]carbamate |
| SMILES | COc1ccc(C(CNC(=O)OC(C)(C)C)N2C(=O)c3cccc(N4CCN([C@@H](C)c5ccccc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C35H42N4O6/c1-23(24-11-8-7-9-12-24)37-17-19-38(20-18-37)27-14-10-13-26-31(27)33(41)39(32(26)40)28(22-36-34(42)45-35(2,3)4)25-15-16-29(43-5)30(21-25)44-6/h7-16,21,23,28H,17-20,22H2,1-6H3,(H,36,42)/t23-,28?/m0/s1 |
| InChIKey | PDSUGZQHFWZCJV-UHFKCPIBSA-N |
| XLogP | 5.45 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.74 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|