C34H36N4O6S2 — CID 45486910
N-[2-(3,4-dimethoxyphenyl)-2-[1,3-dioxo-4-[4-[(1S)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]ethyl]thiophene-2-sulfonamide (PubChem CID 45486910) has the molecular formula C34H36N4O6S2 and a molecular weight of 660.82 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)-2-[1,3-dioxo-4-[4-[(1S)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)-2-[1,3-dioxo-4-[4-[(1S)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 45486910 |
| Molecular Formula | C34H36N4O6S2 |
| Molecular Weight | 660.82 g/mol |
| Exact Mass | 660.21 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)-2-[1,3-dioxo-4-[4-[(1S)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]ethyl]thiophene-2-sulfonamide |
| SMILES | COc1ccc(C(CNS(=O)(=O)c2cccs2)N2C(=O)c3cccc(N4CCN([C@@H](C)c5ccccc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C34H36N4O6S2/c1-23(24-9-5-4-6-10-24)36-16-18-37(19-17-36)27-12-7-11-26-32(27)34(40)38(33(26)39)28(22-35-46(41,42)31-13-8-20-45-31)25-14-15-29(43-2)30(21-25)44-3/h4-15,20-21,23,28,35H,16-19,22H2,1-3H3/t23-,28?/m0/s1 |
| InChIKey | XXTPMBVPKVOGOB-UHFKCPIBSA-N |
| XLogP | 4.96 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.82 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|