C36H44N4O6 — CID 45486911
tert-butyl N-[3-(3,4-dimethoxyphenyl)-3-[1,3-dioxo-4-[4-[(1S)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]propyl]carbamate (PubChem CID 45486911) has the molecular formula C36H44N4O6 and a molecular weight of 628.77 g/mol. Its IUPAC name is tert-butyl N-[3-(3,4-dimethoxyphenyl)-3-[1,3-dioxo-4-[4-[(1S)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-(3,4-dimethoxyphenyl)-3-[1,3-dioxo-4-[4-[(1S)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]propyl]carbamate |
|---|---|
| PubChem CID | 45486911 |
| Molecular Formula | C36H44N4O6 |
| Molecular Weight | 628.77 g/mol |
| Exact Mass | 628.33 |
| IUPAC Name | tert-butyl N-[3-(3,4-dimethoxyphenyl)-3-[1,3-dioxo-4-[4-[(1S)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]propyl]carbamate |
| SMILES | COc1ccc(C(CCNC(=O)OC(C)(C)C)N2C(=O)c3cccc(N4CCN([C@@H](C)c5ccccc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C36H44N4O6/c1-24(25-11-8-7-9-12-25)38-19-21-39(22-20-38)29-14-10-13-27-32(29)34(42)40(33(27)41)28(17-18-37-35(43)46-36(2,3)4)26-15-16-30(44-5)31(23-26)45-6/h7-16,23-24,28H,17-22H2,1-6H3,(H,37,43)/t24-,28?/m0/s1 |
| InChIKey | VXIRZADKDLXOPU-ZZDYIDRTSA-N |
| XLogP | 5.84 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.77 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|