C38H48N4O6 — CID 45486916
tert-butyl N-[(5R)-5-(3,4-dimethoxyphenyl)-5-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]pentyl]carbamate (PubChem CID 45486916) has the molecular formula C38H48N4O6 and a molecular weight of 656.82 g/mol. Its IUPAC name is tert-butyl N-[(5R)-5-(3,4-dimethoxyphenyl)-5-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]pentyl]carbamate.
| Compound Name | tert-butyl N-[(5R)-5-(3,4-dimethoxyphenyl)-5-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]pentyl]carbamate |
|---|---|
| PubChem CID | 45486916 |
| Molecular Formula | C38H48N4O6 |
| Molecular Weight | 656.82 g/mol |
| Exact Mass | 656.36 |
| IUPAC Name | tert-butyl N-[(5R)-5-(3,4-dimethoxyphenyl)-5-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]pentyl]carbamate |
| SMILES | COc1ccc([C@@H](CCCCNC(=O)OC(C)(C)C)N2C(=O)c3cccc(N4CCN([C@H](C)c5ccccc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C38H48N4O6/c1-26(27-13-8-7-9-14-27)40-21-23-41(24-22-40)31-17-12-15-29-34(31)36(44)42(35(29)43)30(28-18-19-32(46-5)33(25-28)47-6)16-10-11-20-39-37(45)48-38(2,3)4/h7-9,12-15,17-19,25-26,30H,10-11,16,20-24H2,1-6H3,(H,39,45)/t26-,30-/m1/s1 |
| InChIKey | KOLWWPAODLKMSJ-PDDLMNHVSA-N |
| XLogP | 6.62 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.82 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|