C24H27F5N4O4 — CID 45487042
N-[(3R,6S)-6-(2,3-difluorophenyl)-2-oxo-1-(2,2,2-trifluoroethyl)azepan-3-yl]-2,4-dioxo-3,9-diazaspiro[5.5]undecane-9-carboxamide (PubChem CID 45487042) has the molecular formula C24H27F5N4O4 and a molecular weight of 530.49 g/mol. Its IUPAC name is N-[(3R,6S)-6-(2,3-difluorophenyl)-2-oxo-1-(2,2,2-trifluoroethyl)azepan-3-yl]-2,4-dioxo-3,9-diazaspiro[5.5]undecane-9-carboxamide.
| Compound Name | N-[(3R,6S)-6-(2,3-difluorophenyl)-2-oxo-1-(2,2,2-trifluoroethyl)azepan-3-yl]-2,4-dioxo-3,9-diazaspiro[5.5]undecane-9-carboxamide |
|---|---|
| PubChem CID | 45487042 |
| Molecular Formula | C24H27F5N4O4 |
| Molecular Weight | 530.49 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | N-[(3R,6S)-6-(2,3-difluorophenyl)-2-oxo-1-(2,2,2-trifluoroethyl)azepan-3-yl]-2,4-dioxo-3,9-diazaspiro[5.5]undecane-9-carboxamide |
| SMILES | O=C1CC2(CCN(C(=O)N[C@@H]3CC[C@@H](c4cccc(F)c4F)CN(CC(F)(F)F)C3=O)CC2)CC(=O)N1 |
| InChI | InChI=1S/C24H27F5N4O4/c25-16-3-1-2-15(20(16)26)14-4-5-17(21(36)33(12-14)13-24(27,28)29)30-22(37)32-8-6-23(7-9-32)10-18(34)31-19(35)11-23/h1-3,14,17H,4-13H2,(H,30,37)(H,31,34,35)/t14-,17-/m1/s1 |
| InChIKey | UESAQJRRXPGUFR-RHSMWYFYSA-N |
| XLogP | 2.83 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|