C23H26F5N5O4 — CID 45487055
N-[(3R,6S)-6-(2,3-difluorophenyl)-2-oxo-1-(2,2,2-trifluoroethyl)azepan-3-yl]-1-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxamide (PubChem CID 45487055) has the molecular formula C23H26F5N5O4 and a molecular weight of 531.48 g/mol. Its IUPAC name is N-[(3R,6S)-6-(2,3-difluorophenyl)-2-oxo-1-(2,2,2-trifluoroethyl)azepan-3-yl]-1-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxamide.
| Compound Name | N-[(3R,6S)-6-(2,3-difluorophenyl)-2-oxo-1-(2,2,2-trifluoroethyl)azepan-3-yl]-1-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 45487055 |
| Molecular Formula | C23H26F5N5O4 |
| Molecular Weight | 531.48 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | N-[(3R,6S)-6-(2,3-difluorophenyl)-2-oxo-1-(2,2,2-trifluoroethyl)azepan-3-yl]-1-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxamide |
| SMILES | CN1C(=O)NC(=O)C12CCN(C(=O)N[C@@H]1CC[C@@H](c3cccc(F)c3F)CN(CC(F)(F)F)C1=O)CC2 |
| InChI | InChI=1S/C23H26F5N5O4/c1-31-20(36)30-19(35)22(31)7-9-32(10-8-22)21(37)29-16-6-5-13(14-3-2-4-15(24)17(14)25)11-33(18(16)34)12-23(26,27)28/h2-4,13,16H,5-12H2,1H3,(H,29,37)(H,30,35,36)/t13-,16-/m1/s1 |
| InChIKey | NOCOFNXJJFFHJU-CZUORRHYSA-N |
| XLogP | 2.33 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|