C18H17ClF3N3O2S — CID 45487146
12-(4-chlorophenyl)sulfonyl-10-[(E)-3,3,3-trifluoroprop-1-enyl]-4,5,12-triazatricyclo[6.3.1.02,6]dodeca-2(6),3-diene (PubChem CID 45487146) has the molecular formula C18H17ClF3N3O2S and a molecular weight of 431.87 g/mol. Its IUPAC name is 12-(4-chlorophenyl)sulfonyl-10-[(E)-3,3,3-trifluoroprop-1-enyl]-4,5,12-triazatricyclo[6.3.1.02,6]dodeca-2(6),3-diene.
| Compound Name | 12-(4-chlorophenyl)sulfonyl-10-[(E)-3,3,3-trifluoroprop-1-enyl]-4,5,12-triazatricyclo[6.3.1.02,6]dodeca-2(6),3-diene |
|---|---|
| PubChem CID | 45487146 |
| Molecular Formula | C18H17ClF3N3O2S |
| Molecular Weight | 431.87 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | 12-(4-chlorophenyl)sulfonyl-10-[(E)-3,3,3-trifluoroprop-1-enyl]-4,5,12-triazatricyclo[6.3.1.02,6]dodeca-2(6),3-diene |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1C2Cc3[nH]ncc3C1CC(/C=C/C(F)(F)F)C2 |
| InChI | InChI=1S/C18H17ClF3N3O2S/c19-12-1-3-14(4-2-12)28(26,27)25-13-7-11(5-6-18(20,21)22)8-17(25)15-10-23-24-16(15)9-13/h1-6,10-11,13,17H,7-9H2,(H,23,24)/b6-5+ |
| InChIKey | IWSZRDMRWOHUTO-AATRIKPKSA-N |
| XLogP | 4.25 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.87 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|