C25H26N2O3 — CID 45487317
1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-naphthalen-1-yloxypropan-1-one (PubChem CID 45487317) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-naphthalen-1-yloxypropan-1-one.
| Compound Name | 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-naphthalen-1-yloxypropan-1-one |
|---|---|
| PubChem CID | 45487317 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-naphthalen-1-yloxypropan-1-one |
| SMILES | CC(Oc1cccc2ccccc12)C(=O)N1CCN(C(=O)c2ccccc2)C[C@H]1C |
| InChI | InChI=1S/C25H26N2O3/c1-18-17-26(25(29)21-10-4-3-5-11-21)15-16-27(18)24(28)19(2)30-23-14-8-12-20-9-6-7-13-22(20)23/h3-14,18-19H,15-17H2,1-2H3/t18-,19?/m1/s1 |
| InChIKey | WHKQWNUTAKNCOO-MRTLOADZSA-N |
| XLogP | 3.98 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |