C22H30N4O5 — CID 45487386
[(5S,6S)-5-(hydroxycarbamoyl)-6-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidin-3-yl] pyrrolidine-1-carboxylate (PubChem CID 45487386) has the molecular formula C22H30N4O5 and a molecular weight of 430.51 g/mol. Its IUPAC name is [(5S,6S)-5-(hydroxycarbamoyl)-6-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidin-3-yl] pyrrolidine-1-carboxylate.
| Compound Name | [(5S,6S)-5-(hydroxycarbamoyl)-6-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidin-3-yl] pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 45487386 |
| Molecular Formula | C22H30N4O5 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | [(5S,6S)-5-(hydroxycarbamoyl)-6-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidin-3-yl] pyrrolidine-1-carboxylate |
| SMILES | O=C(NO)[C@H]1CC(OC(=O)N2CCCC2)CN[C@@H]1C(=O)N1CC[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C22H30N4O5/c27-20(24-30)18-12-17(31-22(29)25-9-4-5-10-25)13-23-19(18)21(28)26-11-8-16(14-26)15-6-2-1-3-7-15/h1-3,6-7,16-19,23,30H,4-5,8-14H2,(H,24,27)/t16-,17?,18-,19-/m0/s1 |
| InChIKey | IWKMSLYRBYXTNT-RNLLHNEJSA-N |
| XLogP | 1.09 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|