C20H26N4O5 — CID 45487387
[(5S,6S)-6-(1,3-dihydroisoindole-2-carbonyl)-5-(hydroxycarbamoyl)piperidin-3-yl] pyrrolidine-1-carboxylate (PubChem CID 45487387) has the molecular formula C20H26N4O5 and a molecular weight of 402.45 g/mol. Its IUPAC name is [(5S,6S)-6-(1,3-dihydroisoindole-2-carbonyl)-5-(hydroxycarbamoyl)piperidin-3-yl] pyrrolidine-1-carboxylate.
| Compound Name | [(5S,6S)-6-(1,3-dihydroisoindole-2-carbonyl)-5-(hydroxycarbamoyl)piperidin-3-yl] pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 45487387 |
| Molecular Formula | C20H26N4O5 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | [(5S,6S)-6-(1,3-dihydroisoindole-2-carbonyl)-5-(hydroxycarbamoyl)piperidin-3-yl] pyrrolidine-1-carboxylate |
| SMILES | O=C(NO)[C@H]1CC(OC(=O)N2CCCC2)CN[C@@H]1C(=O)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C20H26N4O5/c25-18(22-28)16-9-15(29-20(27)23-7-3-4-8-23)10-21-17(16)19(26)24-11-13-5-1-2-6-14(13)12-24/h1-2,5-6,15-17,21,28H,3-4,7-12H2,(H,22,25)/t15?,16-,17-/m0/s1 |
| InChIKey | QHTFXHUNNOAYME-BSOSBYQFSA-N |
| XLogP | 0.61 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|