C23H32N4O4 — CID 45487398
(2S,3S)-N-hydroxy-5-(2-oxo-2-pyrrolidin-1-ylethyl)-2-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidine-3-carboxamide (PubChem CID 45487398) has the molecular formula C23H32N4O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is (2S,3S)-N-hydroxy-5-(2-oxo-2-pyrrolidin-1-ylethyl)-2-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidine-3-carboxamide.
| Compound Name | (2S,3S)-N-hydroxy-5-(2-oxo-2-pyrrolidin-1-ylethyl)-2-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 45487398 |
| Molecular Formula | C23H32N4O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | (2S,3S)-N-hydroxy-5-(2-oxo-2-pyrrolidin-1-ylethyl)-2-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidine-3-carboxamide |
| SMILES | O=C(NO)[C@H]1CC(CC(=O)N2CCCC2)CN[C@@H]1C(=O)N1CC[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C23H32N4O4/c28-20(26-9-4-5-10-26)13-16-12-19(22(29)25-31)21(24-14-16)23(30)27-11-8-18(15-27)17-6-2-1-3-7-17/h1-3,6-7,16,18-19,21,24,31H,4-5,8-15H2,(H,25,29)/t16?,18-,19-,21-/m0/s1 |
| InChIKey | GMXIFCSQVFGFBC-ZRTMLZEBSA-N |
| XLogP | 1.11 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|