C22H32N4O4 — CID 45487399
(2S,3S)-N-hydroxy-5-[methyl(2-methylpropanoyl)amino]-2-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidine-3-carboxamide (PubChem CID 45487399) has the molecular formula C22H32N4O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is (2S,3S)-N-hydroxy-5-[methyl(2-methylpropanoyl)amino]-2-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidine-3-carboxamide.
| Compound Name | (2S,3S)-N-hydroxy-5-[methyl(2-methylpropanoyl)amino]-2-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 45487399 |
| Molecular Formula | C22H32N4O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | (2S,3S)-N-hydroxy-5-[methyl(2-methylpropanoyl)amino]-2-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidine-3-carboxamide |
| SMILES | CC(C)C(=O)N(C)C1CN[C@H](C(=O)N2CC[C@H](c3ccccc3)C2)[C@@H](C(=O)NO)C1 |
| InChI | InChI=1S/C22H32N4O4/c1-14(2)21(28)25(3)17-11-18(20(27)24-30)19(23-12-17)22(29)26-10-9-16(13-26)15-7-5-4-6-8-15/h4-8,14,16-19,23,30H,9-13H2,1-3H3,(H,24,27)/t16-,17?,18-,19-/m0/s1 |
| InChIKey | OKGOBXODUWTHAJ-RNLLHNEJSA-N |
| XLogP | 0.97 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|