C22H39ClN2 — CID 45487536
N'-(2-adamantyl)-N-[(2E)-3,7-dimethylocta-2,6-dienyl]ethane-1,2-diamine;hydrochloride (PubChem CID 45487536) has the molecular formula C22H39ClN2 and a molecular weight of 367.02 g/mol. Its IUPAC name is N'-(2-adamantyl)-N-[(2E)-3,7-dimethylocta-2,6-dienyl]ethane-1,2-diamine;hydrochloride.
| Compound Name | N'-(2-adamantyl)-N-[(2E)-3,7-dimethylocta-2,6-dienyl]ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 45487536 |
| Molecular Formula | C22H39ClN2 |
| Molecular Weight | 367.02 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | N'-(2-adamantyl)-N-[(2E)-3,7-dimethylocta-2,6-dienyl]ethane-1,2-diamine;hydrochloride |
| SMILES | CC(C)=CCC/C(C)=C/CNCCNC1C2CC3CC(C2)CC1C3.Cl |
| InChI | InChI=1S/C22H38N2.ClH/c1-16(2)5-4-6-17(3)7-8-23-9-10-24-22-20-12-18-11-19(14-20)15-21(22)13-18;/h5,7,18-24H,4,6,8-15H2,1-3H3;1H/b17-7+; |
| InChIKey | RZHMMKGXUDVQCD-VYYXIRCESA-N |
| XLogP | 5.10 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.02 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|