C24H21F3N2O2 — CID 45487652
1'-[[4-(3,4-difluorophenoxy)phenyl]methyl]-6-fluorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine] (PubChem CID 45487652) has the molecular formula C24H21F3N2O2 and a molecular weight of 426.44 g/mol. Its IUPAC name is 1'-[[4-(3,4-difluorophenoxy)phenyl]methyl]-6-fluorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine].
| Compound Name | 1'-[[4-(3,4-difluorophenoxy)phenyl]methyl]-6-fluorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine] |
|---|---|
| PubChem CID | 45487652 |
| Molecular Formula | C24H21F3N2O2 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 1'-[[4-(3,4-difluorophenoxy)phenyl]methyl]-6-fluorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine] |
| SMILES | Fc1cc2c(cn1)C1(CCN(Cc3ccc(Oc4ccc(F)c(F)c4)cc3)CC1)OC2 |
| InChI | InChI=1S/C24H21F3N2O2/c25-21-6-5-19(12-22(21)26)31-18-3-1-16(2-4-18)14-29-9-7-24(8-10-29)20-13-28-23(27)11-17(20)15-30-24/h1-6,11-13H,7-10,14-15H2 |
| InChIKey | JFJGUHDHENWREH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|