C24H22F3N3O — CID 45487657
3,4-difluoro-N-[4-[(6-fluorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-1'-yl)methyl]phenyl]aniline (PubChem CID 45487657) has the molecular formula C24H22F3N3O and a molecular weight of 425.45 g/mol. Its IUPAC name is 3,4-difluoro-N-[4-[(6-fluorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-1'-yl)methyl]phenyl]aniline.
| Compound Name | 3,4-difluoro-N-[4-[(6-fluorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-1'-yl)methyl]phenyl]aniline |
|---|---|
| PubChem CID | 45487657 |
| Molecular Formula | C24H22F3N3O |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 3,4-difluoro-N-[4-[(6-fluorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-1'-yl)methyl]phenyl]aniline |
| SMILES | Fc1cc2c(cn1)C1(CCN(Cc3ccc(Nc4ccc(F)c(F)c4)cc3)CC1)OC2 |
| InChI | InChI=1S/C24H22F3N3O/c25-21-6-5-19(12-22(21)26)29-18-3-1-16(2-4-18)14-30-9-7-24(8-10-30)20-13-28-23(27)11-17(20)15-31-24/h1-6,11-13,29H,7-10,14-15H2 |
| InChIKey | KTRMFSXYMXPKHJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|