About [3-[5-(2,6-dimorpholin-4-ylpyrimidin-4-yl)furan-2-yl]phenyl]methanol
[3-[5-(2,6-dimorpholin-4-ylpyrimidin-4-yl)furan-2-yl]phenyl]methanol (PubChem CID 45487715) has the molecular formula C23H26N4O4
and a molecular weight of 422.49 g/mol. Its IUPAC name is [3-[5-(2,6-dimorpholin-4-ylpyrimidin-4-yl)furan-2-yl]phenyl]methanol.
Molecular Properties
| Compound Name | [3-[5-(2,6-dimorpholin-4-ylpyrimidin-4-yl)furan-2-yl]phenyl]methanol |
| PubChem CID | 45487715 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | [3-[5-(2,6-dimorpholin-4-ylpyrimidin-4-yl)furan-2-yl]phenyl]methanol |
| SMILES | OCc1cccc(-c2ccc(-c3cc(N4CCOCC4)nc(N4CCOCC4)n3)o2)c1 |
| InChI | InChI=1S/C23H26N4O4/c28-16-17-2-1-3-18(14-17)20-4-5-21(31-20)19-15-22(26-6-10-29-11-7-26)25-23(24-19)27-8-12-30-13-9-27/h1-5,14-15,28H,6-13,16H2 |
| InChIKey | BXRMHHSERKBUGT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 84.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [3-[5-(2,6-dimorpholin-4-ylpyrimidin-4-yl)furan-2-yl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[5-(2,6-dimorpholin-4-ylpyrimidin-4-yl)furan-2-yl]phenyl]methanol?
The IUPAC name of [3-[5-(2,6-dimorpholin-4-ylpyrimidin-4-yl)furan-2-yl]phenyl]methanol (CID 45487715) is [3-[5-(2,6-dimorpholin-4-ylpyrimidin-4-yl)furan-2-yl]phenyl]methanol.
What is the SMILES notation for [3-[5-(2,6-dimorpholin-4-ylpyrimidin-4-yl)furan-2-yl]phenyl]methanol?
The canonical SMILES for [3-[5-(2,6-dimorpholin-4-ylpyrimidin-4-yl)furan-2-yl]phenyl]methanol is OCc1cccc(-c2ccc(-c3cc(N4CCOCC4)nc(N4CCOCC4)n3)o2)c1.
What is the InChIKey of [3-[5-(2,6-dimorpholin-4-ylpyrimidin-4-yl)furan-2-yl]phenyl]methanol?
The InChIKey is BXRMHHSERKBUGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N4O4/c28-16-17-2-1-3-18(14-17)20-4-5-21(31-20)19-15-22(26-6-10-29-11-7-26)25-23(24-19)27-8-12-30-13-9-27/h1-5,14-15,28H,6-13,16H2.
What are the key properties of [3-[5-(2,6-dimorpholin-4-ylpyrimidin-4-yl)furan-2-yl]phenyl]methanol?
[3-[5-(2,6-dimorpholin-4-ylpyrimidin-4-yl)furan-2-yl]phenyl]methanol has a molecular weight of 422.49 g/mol, XLogP of 2.57, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[5-(2,6-dimorpholin-4-ylpyrimidin-4-yl)furan-2-yl]phenyl]methanol is sourced from PubChem (CID 45487715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).