C30H37ClN6O3 — CID 45487747
2-[(1R)-4-[(6-chloropyrazin-2-yl)amino]-1-(3,4-dimethoxyphenyl)butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one (PubChem CID 45487747) has the molecular formula C30H37ClN6O3 and a molecular weight of 565.12 g/mol. Its IUPAC name is 2-[(1R)-4-[(6-chloropyrazin-2-yl)amino]-1-(3,4-dimethoxyphenyl)butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one.
| Compound Name | 2-[(1R)-4-[(6-chloropyrazin-2-yl)amino]-1-(3,4-dimethoxyphenyl)butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 45487747 |
| Molecular Formula | C30H37ClN6O3 |
| Molecular Weight | 565.12 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | 2-[(1R)-4-[(6-chloropyrazin-2-yl)amino]-1-(3,4-dimethoxyphenyl)butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one |
| SMILES | CCN1CCN(c2cccc3c2CN([C@H](CCCNc2cncc(Cl)n2)c2ccc(OC)c(OC)c2)C3=O)CC1 |
| InChI | InChI=1S/C30H37ClN6O3/c1-4-35-13-15-36(16-14-35)25-8-5-7-22-23(25)20-37(30(22)38)24(21-10-11-26(39-2)27(17-21)40-3)9-6-12-33-29-19-32-18-28(31)34-29/h5,7-8,10-11,17-19,24H,4,6,9,12-16,20H2,1-3H3,(H,33,34)/t24-/m1/s1 |
| InChIKey | PUAHOGRCDQZHHA-XMMPIXPASA-N |
| XLogP | 4.88 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.12 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|