C31H40N6O4 — CID 45487748
2-[(1R)-1-(3,4-dimethoxyphenyl)-4-[(6-methoxypyrazin-2-yl)amino]butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one (PubChem CID 45487748) has the molecular formula C31H40N6O4 and a molecular weight of 560.70 g/mol. Its IUPAC name is 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-[(6-methoxypyrazin-2-yl)amino]butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one.
| Compound Name | 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-[(6-methoxypyrazin-2-yl)amino]butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 45487748 |
| Molecular Formula | C31H40N6O4 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-[(6-methoxypyrazin-2-yl)amino]butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one |
| SMILES | CCN1CCN(c2cccc3c2CN([C@H](CCCNc2cncc(OC)n2)c2ccc(OC)c(OC)c2)C3=O)CC1 |
| InChI | InChI=1S/C31H40N6O4/c1-5-35-14-16-36(17-15-35)26-9-6-8-23-24(26)21-37(31(23)38)25(22-11-12-27(39-2)28(18-22)40-3)10-7-13-33-29-19-32-20-30(34-29)41-4/h6,8-9,11-12,18-20,25H,5,7,10,13-17,21H2,1-4H3,(H,33,34)/t25-/m1/s1 |
| InChIKey | XBIUSFLVEVUSLU-RUZDIDTESA-N |
| XLogP | 4.23 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|