C23H21F3N2O2 — CID 45487797
N-(3,3-diphenylpropyl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide (PubChem CID 45487797) has the molecular formula C23H21F3N2O2 and a molecular weight of 414.43 g/mol. Its IUPAC name is N-(3,3-diphenylpropyl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide.
| Compound Name | N-(3,3-diphenylpropyl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 45487797 |
| Molecular Formula | C23H21F3N2O2 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | N-(3,3-diphenylpropyl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
| SMILES | O=C(NCCC(c1ccccc1)c1ccccc1)c1ccc(OCC(F)(F)F)nc1 |
| InChI | InChI=1S/C23H21F3N2O2/c24-23(25,26)16-30-21-12-11-19(15-28-21)22(29)27-14-13-20(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-12,15,20H,13-14,16H2,(H,27,29) |
| InChIKey | ZATALYYKPYBDOS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |