About 6-amino-N-[(2,4-dichlorophenyl)methyl]pyridine-3-carboxamide
6-amino-N-[(2,4-dichlorophenyl)methyl]pyridine-3-carboxamide (PubChem CID 45487830) has the molecular formula C13H11Cl2N3O
and a molecular weight of 296.16 g/mol. Its IUPAC name is 6-amino-N-[(2,4-dichlorophenyl)methyl]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 6-amino-N-[(2,4-dichlorophenyl)methyl]pyridine-3-carboxamide |
| PubChem CID | 45487830 |
| Molecular Formula | C13H11Cl2N3O |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 6-amino-N-[(2,4-dichlorophenyl)methyl]pyridine-3-carboxamide |
| SMILES | Nc1ccc(C(=O)NCc2ccc(Cl)cc2Cl)cn1 |
| InChI | InChI=1S/C13H11Cl2N3O/c14-10-3-1-8(11(15)5-10)6-18-13(19)9-2-4-12(16)17-7-9/h1-5,7H,6H2,(H2,16,17)(H,18,19) |
| InChIKey | PWGDOYQXBPVPGB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-N-[(2,4-dichlorophenyl)methyl]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-N-[(2,4-dichlorophenyl)methyl]pyridine-3-carboxamide?
The IUPAC name of 6-amino-N-[(2,4-dichlorophenyl)methyl]pyridine-3-carboxamide (CID 45487830) is 6-amino-N-[(2,4-dichlorophenyl)methyl]pyridine-3-carboxamide.
What is the SMILES notation for 6-amino-N-[(2,4-dichlorophenyl)methyl]pyridine-3-carboxamide?
The canonical SMILES for 6-amino-N-[(2,4-dichlorophenyl)methyl]pyridine-3-carboxamide is Nc1ccc(C(=O)NCc2ccc(Cl)cc2Cl)cn1.
What is the InChIKey of 6-amino-N-[(2,4-dichlorophenyl)methyl]pyridine-3-carboxamide?
The InChIKey is PWGDOYQXBPVPGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11Cl2N3O/c14-10-3-1-8(11(15)5-10)6-18-13(19)9-2-4-12(16)17-7-9/h1-5,7H,6H2,(H2,16,17)(H,18,19).
What are the key properties of 6-amino-N-[(2,4-dichlorophenyl)methyl]pyridine-3-carboxamide?
6-amino-N-[(2,4-dichlorophenyl)methyl]pyridine-3-carboxamide has a molecular weight of 296.16 g/mol, XLogP of 2.90, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-N-[(2,4-dichlorophenyl)methyl]pyridine-3-carboxamide is sourced from PubChem (CID 45487830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).