About 2-[5-chloro-2-(4-fluorophenyl)-3-pyridin-4-ylimidazo[1,2-a]pyridin-7-yl]ethanol
2-[5-chloro-2-(4-fluorophenyl)-3-pyridin-4-ylimidazo[1,2-a]pyridin-7-yl]ethanol (PubChem CID 45487937) has the molecular formula C20H15ClFN3O
and a molecular weight of 367.81 g/mol. Its IUPAC name is 2-[5-chloro-2-(4-fluorophenyl)-3-pyridin-4-ylimidazo[1,2-a]pyridin-7-yl]ethanol.
Molecular Properties
| Compound Name | 2-[5-chloro-2-(4-fluorophenyl)-3-pyridin-4-ylimidazo[1,2-a]pyridin-7-yl]ethanol |
| PubChem CID | 45487937 |
| Molecular Formula | C20H15ClFN3O |
| Molecular Weight | 367.81 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 2-[5-chloro-2-(4-fluorophenyl)-3-pyridin-4-ylimidazo[1,2-a]pyridin-7-yl]ethanol |
| SMILES | OCCc1cc(Cl)n2c(-c3ccncc3)c(-c3ccc(F)cc3)nc2c1 |
| InChI | InChI=1S/C20H15ClFN3O/c21-17-11-13(7-10-26)12-18-24-19(14-1-3-16(22)4-2-14)20(25(17)18)15-5-8-23-9-6-15/h1-6,8-9,11-12,26H,7,10H2 |
| InChIKey | BTVZYVFJLRSSCW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.81 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-chloro-2-(4-fluorophenyl)-3-pyridin-4-ylimidazo[1,2-a]pyridin-7-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-chloro-2-(4-fluorophenyl)-3-pyridin-4-ylimidazo[1,2-a]pyridin-7-yl]ethanol?
The IUPAC name of 2-[5-chloro-2-(4-fluorophenyl)-3-pyridin-4-ylimidazo[1,2-a]pyridin-7-yl]ethanol (CID 45487937) is 2-[5-chloro-2-(4-fluorophenyl)-3-pyridin-4-ylimidazo[1,2-a]pyridin-7-yl]ethanol.
What is the SMILES notation for 2-[5-chloro-2-(4-fluorophenyl)-3-pyridin-4-ylimidazo[1,2-a]pyridin-7-yl]ethanol?
The canonical SMILES for 2-[5-chloro-2-(4-fluorophenyl)-3-pyridin-4-ylimidazo[1,2-a]pyridin-7-yl]ethanol is OCCc1cc(Cl)n2c(-c3ccncc3)c(-c3ccc(F)cc3)nc2c1.
What is the InChIKey of 2-[5-chloro-2-(4-fluorophenyl)-3-pyridin-4-ylimidazo[1,2-a]pyridin-7-yl]ethanol?
The InChIKey is BTVZYVFJLRSSCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15ClFN3O/c21-17-11-13(7-10-26)12-18-24-19(14-1-3-16(22)4-2-14)20(25(17)18)15-5-8-23-9-6-15/h1-6,8-9,11-12,26H,7,10H2.
What are the key properties of 2-[5-chloro-2-(4-fluorophenyl)-3-pyridin-4-ylimidazo[1,2-a]pyridin-7-yl]ethanol?
2-[5-chloro-2-(4-fluorophenyl)-3-pyridin-4-ylimidazo[1,2-a]pyridin-7-yl]ethanol has a molecular weight of 367.81 g/mol, XLogP of 4.39, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-chloro-2-(4-fluorophenyl)-3-pyridin-4-ylimidazo[1,2-a]pyridin-7-yl]ethanol is sourced from PubChem (CID 45487937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).