C20H19F3N6O2 — CID 45487946
(3R)-3-amino-1-[(2S)-2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 45487946) has the molecular formula C20H19F3N6O2 and a molecular weight of 432.41 g/mol. Its IUPAC name is (3R)-3-amino-1-[(2S)-2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | (3R)-3-amino-1-[(2S)-2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 45487946 |
| Molecular Formula | C20H19F3N6O2 |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | (3R)-3-amino-1-[(2S)-2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | N[C@@H](CC(=O)N1CCC[C@H]1c1nc(-c2cnccn2)no1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C20H19F3N6O2/c21-13-9-15(23)14(22)7-11(13)6-12(24)8-18(30)29-5-1-2-17(29)20-27-19(28-31-20)16-10-25-3-4-26-16/h3-4,7,9-10,12,17H,1-2,5-6,8,24H2/t12-,17+/m1/s1 |
| InChIKey | DRUXRRHZZFHBIA-PXAZEXFGSA-N |
| XLogP | 2.57 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|