C21H31N6O9P — CID 45487947
(E)-but-2-enedioic acid;methyl (2S)-2-[(2R)-2-[2-(6-aminopurin-9-yl)ethoxymethyl]-2-oxo-1,3,2λ5-oxazaphosphinan-3-yl]-3-methylbutanoate (PubChem CID 45487947) has the molecular formula C21H31N6O9P and a molecular weight of 542.49 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;methyl (2S)-2-[(2R)-2-[2-(6-aminopurin-9-yl)ethoxymethyl]-2-oxo-1,3,2λ5-oxazaphosphinan-3-yl]-3-methylbutanoate.
| Compound Name | (E)-but-2-enedioic acid;methyl (2S)-2-[(2R)-2-[2-(6-aminopurin-9-yl)ethoxymethyl]-2-oxo-1,3,2λ5-oxazaphosphinan-3-yl]-3-methylbutanoate |
|---|---|
| PubChem CID | 45487947 |
| Molecular Formula | C21H31N6O9P |
| Molecular Weight | 542.49 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | (E)-but-2-enedioic acid;methyl (2S)-2-[(2R)-2-[2-(6-aminopurin-9-yl)ethoxymethyl]-2-oxo-1,3,2λ5-oxazaphosphinan-3-yl]-3-methylbutanoate |
| SMILES | COC(=O)[C@H](C(C)C)N1CCCO[P@]1(=O)COCCn1cnc2c(N)ncnc21.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H27N6O5P.C4H4O4/c1-12(2)14(17(24)26-3)23-5-4-7-28-29(23,25)11-27-8-6-22-10-21-13-15(18)19-9-20-16(13)22;5-3(6)1-2-4(7)8/h9-10,12,14H,4-8,11H2,1-3H3,(H2,18,19,20);1-2H,(H,5,6)(H,7,8)/b;2-1+/t14-,29+;/m0./s1 |
| InChIKey | ZIFVOYKZJCOGHT-SXMNZCTQSA-N |
| XLogP | 1.21 |
| TPSA | 209.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.49 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|