C22H24ClFO5 — CID 45488013
(3S,3'R,4'S,5'S,6'S)-6-chloro-7-[(4-ethylphenyl)methyl]-6'-(fluoromethyl)spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol (PubChem CID 45488013) has the molecular formula C22H24ClFO5 and a molecular weight of 422.88 g/mol. Its IUPAC name is (3S,3'R,4'S,5'S,6'S)-6-chloro-7-[(4-ethylphenyl)methyl]-6'-(fluoromethyl)spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol.
| Compound Name | (3S,3'R,4'S,5'S,6'S)-6-chloro-7-[(4-ethylphenyl)methyl]-6'-(fluoromethyl)spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
|---|---|
| PubChem CID | 45488013 |
| Molecular Formula | C22H24ClFO5 |
| Molecular Weight | 422.88 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | (3S,3'R,4'S,5'S,6'S)-6-chloro-7-[(4-ethylphenyl)methyl]-6'-(fluoromethyl)spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
| SMILES | CCc1ccc(Cc2c(Cl)ccc3c2CO[C@]32O[C@H](CF)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C22H24ClFO5/c1-2-12-3-5-13(6-4-12)9-14-15-11-28-22(16(15)7-8-17(14)23)21(27)20(26)19(25)18(10-24)29-22/h3-8,18-21,25-27H,2,9-11H2,1H3/t18-,19-,20+,21-,22+/m1/s1 |
| InChIKey | XLBGHHHXSZPCEK-BDHVOXNPSA-N |
| XLogP | 2.63 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.88 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |