C29H30F3N3O2 — CID 45488249
[2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3-(trifluoromethyl)benzoate (PubChem CID 45488249) has the molecular formula C29H30F3N3O2 and a molecular weight of 509.57 g/mol. Its IUPAC name is [2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3-(trifluoromethyl)benzoate.
| Compound Name | [2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 45488249 |
| Molecular Formula | C29H30F3N3O2 |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | [2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3-(trifluoromethyl)benzoate |
| SMILES | CC(C)(C)CC(C)(C)Nc1c(-c2ccccc2OC(=O)c2cccc(C(F)(F)F)c2)nc2ccccn12 |
| InChI | InChI=1S/C29H30F3N3O2/c1-27(2,3)18-28(4,5)34-25-24(33-23-15-8-9-16-35(23)25)21-13-6-7-14-22(21)37-26(36)19-11-10-12-20(17-19)29(30,31)32/h6-17,34H,18H2,1-5H3 |
| InChIKey | PEHQJRMXGWWBGM-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|