C13H17N5O2 — CID 45488314
5-[(3,5-dimethoxyanilino)methyl]pyrimidine-2,4-diamine (PubChem CID 45488314) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 5-[(3,5-dimethoxyanilino)methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[(3,5-dimethoxyanilino)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 45488314 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 5-[(3,5-dimethoxyanilino)methyl]pyrimidine-2,4-diamine |
| SMILES | COc1cc(NCc2cnc(N)nc2N)cc(OC)c1 |
| InChI | InChI=1S/C13H17N5O2/c1-19-10-3-9(4-11(5-10)20-2)16-6-8-7-17-13(15)18-12(8)14/h3-5,7,16H,6H2,1-2H3,(H4,14,15,17,18) |
| InChIKey | NYFAOAVMEREVOA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |