About 1-ethyl-3-[2-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylethyl]urea
1-ethyl-3-[2-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylethyl]urea (PubChem CID 45488330) has the molecular formula C22H26N4OS
and a molecular weight of 394.54 g/mol. Its IUPAC name is 1-ethyl-3-[2-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylethyl]urea.
Molecular Properties
| Compound Name | 1-ethyl-3-[2-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylethyl]urea |
| PubChem CID | 45488330 |
| Molecular Formula | C22H26N4OS |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 1-ethyl-3-[2-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylethyl]urea |
| SMILES | CCNC(=O)NCCSc1nc(-c2ccccc2)c(-c2ccccc2)n1CC |
| InChI | InChI=1S/C22H26N4OS/c1-3-23-21(27)24-15-16-28-22-25-19(17-11-7-5-8-12-17)20(26(22)4-2)18-13-9-6-10-14-18/h5-14H,3-4,15-16H2,1-2H3,(H2,23,24,27) |
| InChIKey | BYYYSQYDDBVPQJ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-[2-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-[2-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylethyl]urea?
The IUPAC name of 1-ethyl-3-[2-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylethyl]urea (CID 45488330) is 1-ethyl-3-[2-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylethyl]urea.
What is the SMILES notation for 1-ethyl-3-[2-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylethyl]urea?
The canonical SMILES for 1-ethyl-3-[2-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylethyl]urea is CCNC(=O)NCCSc1nc(-c2ccccc2)c(-c2ccccc2)n1CC.
What is the InChIKey of 1-ethyl-3-[2-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylethyl]urea?
The InChIKey is BYYYSQYDDBVPQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N4OS/c1-3-23-21(27)24-15-16-28-22-25-19(17-11-7-5-8-12-17)20(26(22)4-2)18-13-9-6-10-14-18/h5-14H,3-4,15-16H2,1-2H3,(H2,23,24,27).
What are the key properties of 1-ethyl-3-[2-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylethyl]urea?
1-ethyl-3-[2-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylethyl]urea has a molecular weight of 394.54 g/mol, XLogP of 4.65, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-[2-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylethyl]urea is sourced from PubChem (CID 45488330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).